C20H20Cl2O6 — CID 54545376
(3R,6S)-1,8-bis(2-chlorophenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione (PubChem CID 54545376) has the molecular formula C20H20Cl2O6 and a molecular weight of 427.28 g/mol. Its IUPAC name is (3R,6S)-1,8-bis(2-chlorophenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione.
| Compound Name | (3R,6S)-1,8-bis(2-chlorophenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione |
|---|---|
| PubChem CID | 54545376 |
| Molecular Formula | C20H20Cl2O6 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (3R,6S)-1,8-bis(2-chlorophenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione |
| SMILES | O=C(C(=O)[C@H](O)C(O)Cc1ccccc1Cl)[C@@H](O)C(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C20H20Cl2O6/c21-13-7-3-1-5-11(13)9-15(23)17(25)19(27)20(28)18(26)16(24)10-12-6-2-4-8-14(12)22/h1-8,15-18,23-26H,9-10H2/t15?,16?,17-,18+ |
| InChIKey | ZGDZGICMYRQYOK-OWCVQMPJSA-N |
| XLogP | 1.36 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|