C14H19ClO5 — CID 159278588
(3R,4S,5R,6R)-1-(2-chlorophenyl)-3,4,5,6-tetrahydroxyoctan-2-one (PubChem CID 159278588) has the molecular formula C14H19ClO5 and a molecular weight of 302.75 g/mol. Its IUPAC name is (3R,4S,5R,6R)-1-(2-chlorophenyl)-3,4,5,6-tetrahydroxyoctan-2-one.
| Compound Name | (3R,4S,5R,6R)-1-(2-chlorophenyl)-3,4,5,6-tetrahydroxyoctan-2-one |
|---|---|
| PubChem CID | 159278588 |
| Molecular Formula | C14H19ClO5 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (3R,4S,5R,6R)-1-(2-chlorophenyl)-3,4,5,6-tetrahydroxyoctan-2-one |
| SMILES | CC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H19ClO5/c1-2-10(16)12(18)14(20)13(19)11(17)7-8-5-3-4-6-9(8)15/h3-6,10,12-14,16,18-20H,2,7H2,1H3/t10-,12-,13+,14+/m1/s1 |
| InChIKey | UZQGYUAYSPXHAH-ZZVYKPCYSA-N |
| XLogP | 0.31 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |