C14H18BrClO2 — CID 103458580
1-(4-bromo-2-chlorophenyl)-4-ethyl-3-hydroxyhexan-2-one (PubChem CID 103458580) has the molecular formula C14H18BrClO2 and a molecular weight of 333.65 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-4-ethyl-3-hydroxyhexan-2-one.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-4-ethyl-3-hydroxyhexan-2-one |
|---|---|
| PubChem CID | 103458580 |
| Molecular Formula | C14H18BrClO2 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-4-ethyl-3-hydroxyhexan-2-one |
| SMILES | CCC(CC)C(O)C(=O)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H18BrClO2/c1-3-9(4-2)14(18)13(17)7-10-5-6-11(15)8-12(10)16/h5-6,8-9,14,18H,3-4,7H2,1-2H3 |
| InChIKey | ZHBRACRZZRATET-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |