C12H14BrClO2 — CID 103446834
1-(4-bromo-2-chlorophenyl)-3-hydroxy-3-methylpentan-2-one (PubChem CID 103446834) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-hydroxy-3-methylpentan-2-one.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-hydroxy-3-methylpentan-2-one |
|---|---|
| PubChem CID | 103446834 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-hydroxy-3-methylpentan-2-one |
| SMILES | CCC(C)(O)C(=O)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H14BrClO2/c1-3-12(2,16)11(15)6-8-4-5-9(13)7-10(8)14/h4-5,7,16H,3,6H2,1-2H3 |
| InChIKey | GMWHKHHVSCCSGM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |