C18H19BrClNO — CID 171934642
N-[(4-bromo-2-chlorophenyl)methyl]-4-tert-butylbenzamide (PubChem CID 171934642) has the molecular formula C18H19BrClNO and a molecular weight of 380.71 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-4-tert-butylbenzamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 171934642 |
| Molecular Formula | C18H19BrClNO |
| Molecular Weight | 380.71 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19BrClNO/c1-18(2,3)14-7-4-12(5-8-14)17(22)21-11-13-6-9-15(19)10-16(13)20/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | UGEXFGOMDDUPFS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |