C20H21Cl2NO3 — CID 7891762
[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 4-tert-butylbenzoate (PubChem CID 7891762) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 4-tert-butylbenzoate.
| Compound Name | [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 7891762 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCC(=O)NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3/c1-20(2,3)15-7-4-13(5-8-15)19(25)26-12-18(24)23-11-14-6-9-16(21)10-17(14)22/h4-10H,11-12H2,1-3H3,(H,23,24) |
| InChIKey | DKGKWFDAAVAPCO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |