C20H22Cl2N2O2 — CID 6905651
2-[(E)-(4-tert-butylphenyl)methylideneamino]oxy-N-[(2,4-dichlorophenyl)methyl]acetamide (PubChem CID 6905651) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 2-[(E)-(4-tert-butylphenyl)methylideneamino]oxy-N-[(2,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-[(E)-(4-tert-butylphenyl)methylideneamino]oxy-N-[(2,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 6905651 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[(E)-(4-tert-butylphenyl)methylideneamino]oxy-N-[(2,4-dichlorophenyl)methyl]acetamide |
| SMILES | CC(C)(C)c1ccc(/C=N/OCC(=O)NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-20(2,3)16-7-4-14(5-8-16)11-24-26-13-19(25)23-12-15-6-9-17(21)10-18(15)22/h4-11H,12-13H2,1-3H3,(H,23,25)/b24-11+ |
| InChIKey | ZYDSQADDGQJCHC-BHGWPJFGSA-N |
| XLogP | 4.96 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|