C10H9ClI2O2 — CID 166922003
(3R)-4-(4-chlorophenyl)-3-hydroxy-1,1-diiodobutan-2-one (PubChem CID 166922003) has the molecular formula C10H9ClI2O2 and a molecular weight of 450.44 g/mol. Its IUPAC name is (3R)-4-(4-chlorophenyl)-3-hydroxy-1,1-diiodobutan-2-one.
| Compound Name | (3R)-4-(4-chlorophenyl)-3-hydroxy-1,1-diiodobutan-2-one |
|---|---|
| PubChem CID | 166922003 |
| Molecular Formula | C10H9ClI2O2 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 449.84 |
| IUPAC Name | (3R)-4-(4-chlorophenyl)-3-hydroxy-1,1-diiodobutan-2-one |
| SMILES | O=C(C(I)I)[C@H](O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClI2O2/c11-7-3-1-6(2-4-7)5-8(14)9(15)10(12)13/h1-4,8,10,14H,5H2/t8-/m1/s1 |
| InChIKey | AXJZCYWTUZKUOQ-MRVPVSSYSA-N |
| XLogP | 3.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|