C22H31NO4 — CID 90738494
(2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid (PubChem CID 90738494) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid.
| Compound Name | (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid |
|---|---|
| PubChem CID | 90738494 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid |
| SMILES | CO[C@@H](Cc1ccccc1)[C@@H](C)C=C(C)C=CC(NC(C)=O)[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H31NO4/c1-15(11-12-20(23-18(4)24)17(3)22(25)26)13-16(2)21(27-5)14-19-9-7-6-8-10-19/h6-13,16-17,20-21H,14H2,1-5H3,(H,23,24)(H,25,26)/t16-,17-,20?,21-/m0/s1 |
| InChIKey | KTFSVBWDKVQAQE-MXKYORRBSA-N |
| XLogP | 3.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|