C38H62N4O10 — CID 173494657
bis(2-acetamido-3-phenylpropanoic acid);1-[(2R)-1,1-dimethoxy-4-methylpentan-2-yl]-2-[(2S)-1,1-dimethoxy-4-methylpentan-2-yl]hydrazine (PubChem CID 173494657) has the molecular formula C38H62N4O10 and a molecular weight of 734.93 g/mol. Its IUPAC name is bis(2-acetamido-3-phenylpropanoic acid);1-[(2R)-1,1-dimethoxy-4-methylpentan-2-yl]-2-[(2S)-1,1-dimethoxy-4-methylpentan-2-yl]hydrazine.
| Compound Name | bis(2-acetamido-3-phenylpropanoic acid);1-[(2R)-1,1-dimethoxy-4-methylpentan-2-yl]-2-[(2S)-1,1-dimethoxy-4-methylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 173494657 |
| Molecular Formula | C38H62N4O10 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.45 |
| IUPAC Name | bis(2-acetamido-3-phenylpropanoic acid);1-[(2R)-1,1-dimethoxy-4-methylpentan-2-yl]-2-[(2S)-1,1-dimethoxy-4-methylpentan-2-yl]hydrazine |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)O.CC(=O)NC(Cc1ccccc1)C(=O)O.COC(OC)[C@H](CC(C)C)NN[C@H](CC(C)C)C(OC)OC |
| InChI | InChI=1S/C16H36N2O4.2C11H13NO3/c1-11(2)9-13(15(19-5)20-6)17-18-14(10-12(3)4)16(21-7)22-8;2*1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h11-18H,9-10H2,1-8H3;2*2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t13-,14+;; |
| InChIKey | GJDDVQPDWFZMJJ-DUFSSLHGSA-N |
| XLogP | 3.78 |
| TPSA | 193.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|