C23H32N2O5 — CID 173033445
2-acetamido-3-phenylpropanoic acid;(2R)-1,1-dimethoxy-4-phenylbutan-2-amine (PubChem CID 173033445) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-acetamido-3-phenylpropanoic acid;(2R)-1,1-dimethoxy-4-phenylbutan-2-amine.
| Compound Name | 2-acetamido-3-phenylpropanoic acid;(2R)-1,1-dimethoxy-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 173033445 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-acetamido-3-phenylpropanoic acid;(2R)-1,1-dimethoxy-4-phenylbutan-2-amine |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)O.COC(OC)[C@H](N)CCc1ccccc1 |
| InChI | InChI=1S/C12H19NO2.C11H13NO3/c1-14-12(15-2)11(13)9-8-10-6-4-3-5-7-10;1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h3-7,11-12H,8-9,13H2,1-2H3;2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t11-;/m1./s1 |
| InChIKey | BHBKXDBSFGXDSU-RFVHGSKJSA-N |
| XLogP | 2.38 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|