C23H33NO4 — CID 91307008
methyl (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoate (PubChem CID 91307008) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is methyl (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoate.
| Compound Name | methyl (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoate |
|---|---|
| PubChem CID | 91307008 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | methyl (2S,8S,9S)-3-acetamido-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoate |
| SMILES | COC(=O)[C@@H](C)C(C=CC(C)=C[C@H](C)[C@H](Cc1ccccc1)OC)NC(C)=O |
| InChI | InChI=1S/C23H33NO4/c1-16(12-13-21(24-19(4)25)18(3)23(26)28-6)14-17(2)22(27-5)15-20-10-8-7-9-11-20/h7-14,17-18,21-22H,15H2,1-6H3,(H,24,25)/t17-,18-,21?,22-/m0/s1 |
| InChIKey | OVWFOOXSDITTDY-KDLUNRIASA-N |
| XLogP | 3.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|