C28H32N2O6 — CID 101339464
2-[[(2S,3S,4E,6E)-3-acetamido-7-(2-benzylphenyl)-2,6-dimethylhepta-4,6-dienoyl]-(carboxymethyl)amino]acetic acid (PubChem CID 101339464) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-[[(2S,3S,4E,6E)-3-acetamido-7-(2-benzylphenyl)-2,6-dimethylhepta-4,6-dienoyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(2S,3S,4E,6E)-3-acetamido-7-(2-benzylphenyl)-2,6-dimethylhepta-4,6-dienoyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 101339464 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 2-[[(2S,3S,4E,6E)-3-acetamido-7-(2-benzylphenyl)-2,6-dimethylhepta-4,6-dienoyl]-(carboxymethyl)amino]acetic acid |
| SMILES | CC(=O)N[C@@H](/C=C/C(C)=C/c1ccccc1Cc1ccccc1)[C@H](C)C(=O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C28H32N2O6/c1-19(15-23-11-7-8-12-24(23)16-22-9-5-4-6-10-22)13-14-25(29-21(3)31)20(2)28(36)30(17-26(32)33)18-27(34)35/h4-15,20,25H,16-18H2,1-3H3,(H,29,31)(H,32,33)(H,34,35)/b14-13+,19-15+/t20-,25-/m0/s1 |
| InChIKey | MDNBBVTYNADQIL-LTZOYHKPSA-N |
| XLogP | 3.38 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|