C22H27NO5 — CID 18610472
N-[(2R,3R,4S,5R)-5-hydroxy-1-oxo-3,4-bis(phenylmethoxy)hexan-2-yl]acetamide (PubChem CID 18610472) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-5-hydroxy-1-oxo-3,4-bis(phenylmethoxy)hexan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4S,5R)-5-hydroxy-1-oxo-3,4-bis(phenylmethoxy)hexan-2-yl]acetamide |
|---|---|
| PubChem CID | 18610472 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[(2R,3R,4S,5R)-5-hydroxy-1-oxo-3,4-bis(phenylmethoxy)hexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C22H27NO5/c1-16(25)21(27-14-18-9-5-3-6-10-18)22(20(13-24)23-17(2)26)28-15-19-11-7-4-8-12-19/h3-13,16,20-22,25H,14-15H2,1-2H3,(H,23,26)/t16-,20+,21+,22-/m1/s1 |
| InChIKey | AMGYHKKGWMZJHK-YPVJZLTNSA-N |
| XLogP | 2.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|