C35H51NO4Si — CID 10793304
tert-butyl N-[(1S,2Z,4E,6S,7S)-1-[(2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-methyloxolan-2-yl]-7-methoxy-4,6-dimethyl-8-phenylocta-2,4-dienyl]carbamate (PubChem CID 10793304) has the molecular formula C35H51NO4Si and a molecular weight of 577.88 g/mol. Its IUPAC name is tert-butyl N-[(1S,2Z,4E,6S,7S)-1-[(2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-methyloxolan-2-yl]-7-methoxy-4,6-dimethyl-8-phenylocta-2,4-dienyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2Z,4E,6S,7S)-1-[(2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-methyloxolan-2-yl]-7-methoxy-4,6-dimethyl-8-phenylocta-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 10793304 |
| Molecular Formula | C35H51NO4Si |
| Molecular Weight | 577.88 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | tert-butyl N-[(1S,2Z,4E,6S,7S)-1-[(2R,3S,4R)-3-[dimethyl(phenyl)silyl]-4-methyloxolan-2-yl]-7-methoxy-4,6-dimethyl-8-phenylocta-2,4-dienyl]carbamate |
| SMILES | CO[C@@H](Cc1ccccc1)[C@@H](C)/C=C(C)/C=C\[C@H](NC(=O)OC(C)(C)C)[C@H]1OC[C@@H](C)[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C35H51NO4Si/c1-25(22-26(2)31(38-7)23-28-16-12-10-13-17-28)20-21-30(36-34(37)40-35(4,5)6)32-33(27(3)24-39-32)41(8,9)29-18-14-11-15-19-29/h10-22,26-27,30-33H,23-24H2,1-9H3,(H,36,37)/b21-20-,25-22+/t26-,27+,30-,31-,32+,33-/m0/s1 |
| InChIKey | SMDPHOMUONUUOC-IEJZQRCRSA-N |
| XLogP | 7.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.88 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|