C21H31NO4 — CID 154946774
tert-butyl N-[(E,2S)-4-[(2S)-5-phenylmethoxyoxan-2-yl]but-3-en-2-yl]carbamate (PubChem CID 154946774) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-4-[(2S)-5-phenylmethoxyoxan-2-yl]but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-4-[(2S)-5-phenylmethoxyoxan-2-yl]but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 154946774 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl N-[(E,2S)-4-[(2S)-5-phenylmethoxyoxan-2-yl]but-3-en-2-yl]carbamate |
| SMILES | C[C@@H](/C=C/[C@@H]1CCC(OCc2ccccc2)CO1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO4/c1-16(22-20(23)26-21(2,3)4)10-11-18-12-13-19(15-25-18)24-14-17-8-6-5-7-9-17/h5-11,16,18-19H,12-15H2,1-4H3,(H,22,23)/b11-10+/t16-,18+,19?/m0/s1 |
| InChIKey | RQODWDHNMLSASY-BGMRBXMRSA-N |
| XLogP | 4.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|