C24H38O — CID 10736108
[(2S,3S,4E,6E)-7-ethyl-2-methoxy-3,5-dimethyltrideca-4,6-dienyl]benzene (PubChem CID 10736108) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is [(2S,3S,4E,6E)-7-ethyl-2-methoxy-3,5-dimethyltrideca-4,6-dienyl]benzene.
| Compound Name | [(2S,3S,4E,6E)-7-ethyl-2-methoxy-3,5-dimethyltrideca-4,6-dienyl]benzene |
|---|---|
| PubChem CID | 10736108 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | [(2S,3S,4E,6E)-7-ethyl-2-methoxy-3,5-dimethyltrideca-4,6-dienyl]benzene |
| SMILES | CCCCCC/C(=C/C(C)=C/[C@H](C)[C@H](Cc1ccccc1)OC)CC |
| InChI | InChI=1S/C24H38O/c1-6-8-9-11-14-22(7-2)18-20(3)17-21(4)24(25-5)19-23-15-12-10-13-16-23/h10,12-13,15-18,21,24H,6-9,11,14,19H2,1-5H3/b20-17+,22-18+/t21-,24-/m0/s1 |
| InChIKey | XNUAUGHROGIHQE-BFGKCRMESA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|