About 2-methoxyoctylbenzene
2-methoxyoctylbenzene (PubChem CID 102054372) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-methoxyoctylbenzene.
Molecular Properties
| Compound Name | 2-methoxyoctylbenzene |
| PubChem CID | 102054372 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-methoxyoctylbenzene |
| SMILES | CCCCCCC(Cc1ccccc1)OC |
| InChI | InChI=1S/C15H24O/c1-3-4-5-9-12-15(16-2)13-14-10-7-6-8-11-14/h6-8,10-11,15H,3-5,9,12-13H2,1-2H3 |
| InChIKey | GTSQKJQZZNQREY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyoctylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyoctylbenzene?
The IUPAC name of 2-methoxyoctylbenzene (CID 102054372) is 2-methoxyoctylbenzene.
What is the SMILES notation for 2-methoxyoctylbenzene?
The canonical SMILES for 2-methoxyoctylbenzene is CCCCCCC(Cc1ccccc1)OC.
What is the InChIKey of 2-methoxyoctylbenzene?
The InChIKey is GTSQKJQZZNQREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-3-4-5-9-12-15(16-2)13-14-10-7-6-8-11-14/h6-8,10-11,15H,3-5,9,12-13H2,1-2H3.
What are the key properties of 2-methoxyoctylbenzene?
2-methoxyoctylbenzene has a molecular weight of 220.36 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyoctylbenzene is sourced from PubChem (CID 102054372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).