C14H15NO2S2 — CID 135132913
2-[(2Z,4E)-3-methylhexa-2,4-dienyl]sulfonyl-1,3-benzothiazole (PubChem CID 135132913) has the molecular formula C14H15NO2S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[(2Z,4E)-3-methylhexa-2,4-dienyl]sulfonyl-1,3-benzothiazole.
| Compound Name | 2-[(2Z,4E)-3-methylhexa-2,4-dienyl]sulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 135132913 |
| Molecular Formula | C14H15NO2S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-[(2Z,4E)-3-methylhexa-2,4-dienyl]sulfonyl-1,3-benzothiazole |
| SMILES | C/C=C/C(C)=C\CS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H15NO2S2/c1-3-6-11(2)9-10-19(16,17)14-15-12-7-4-5-8-13(12)18-14/h3-9H,10H2,1-2H3/b6-3+,11-9- |
| InChIKey | FMWRWKRQHMKCST-LZNORFLLSA-N |
| XLogP | 3.59 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|