C22H27NO2S2 — CID 177250694
2-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonyl-1,3-benzothiazole (PubChem CID 177250694) has the molecular formula C22H27NO2S2 and a molecular weight of 401.60 g/mol. Its IUPAC name is 2-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonyl-1,3-benzothiazole.
| Compound Name | 2-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 177250694 |
| Molecular Formula | C22H27NO2S2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonyl-1,3-benzothiazole |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CCS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H27NO2S2/c1-16(11-12-18-17(2)8-7-14-22(18,3)4)13-15-27(24,25)21-23-19-9-5-6-10-20(19)26-21/h5-6,9-13H,7-8,14-15H2,1-4H3 |
| InChIKey | YZZFTCVYXREHHM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|