C12H12N2O3S2 — CID 175248868
N-(1,3-benzothiazol-2-ylsulfonyl)-N-prop-2-enylacetamide (PubChem CID 175248868) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfonyl)-N-prop-2-enylacetamide.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfonyl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 175248868 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfonyl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(C)=O)S(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12N2O3S2/c1-3-8-14(9(2)15)19(16,17)12-13-10-6-4-5-7-11(10)18-12/h3-7H,1,8H2,2H3 |
| InChIKey | TZDZUAVQOIQDLX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|