C23H32N2O4S2 — CID 25132204
tert-butyl N-[4-[(E)-4-(1,3-benzothiazol-2-ylsulfonyl)-3-methylbut-2-enyl]cyclohexyl]carbamate (PubChem CID 25132204) has the molecular formula C23H32N2O4S2 and a molecular weight of 464.65 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-4-(1,3-benzothiazol-2-ylsulfonyl)-3-methylbut-2-enyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-4-(1,3-benzothiazol-2-ylsulfonyl)-3-methylbut-2-enyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 25132204 |
| Molecular Formula | C23H32N2O4S2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | tert-butyl N-[4-[(E)-4-(1,3-benzothiazol-2-ylsulfonyl)-3-methylbut-2-enyl]cyclohexyl]carbamate |
| SMILES | C/C(=C\CC1CCC(NC(=O)OC(C)(C)C)CC1)CS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H32N2O4S2/c1-16(15-31(27,28)22-25-19-7-5-6-8-20(19)30-22)9-10-17-11-13-18(14-12-17)24-21(26)29-23(2,3)4/h5-9,17-18H,10-15H2,1-4H3,(H,24,26)/b16-9+ |
| InChIKey | JIVGNLWFSXTGPJ-CXUHLZMHSA-N |
| XLogP | 5.49 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|