C14H20F3NO3S — CID 59771647
3-[[2-methyl-1-[2-(trifluoromethyl)phenyl]propan-2-yl]amino]propane-1-sulfonic acid (PubChem CID 59771647) has the molecular formula C14H20F3NO3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[[2-methyl-1-[2-(trifluoromethyl)phenyl]propan-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[2-methyl-1-[2-(trifluoromethyl)phenyl]propan-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59771647 |
| Molecular Formula | C14H20F3NO3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-[[2-methyl-1-[2-(trifluoromethyl)phenyl]propan-2-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)(Cc1ccccc1C(F)(F)F)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C14H20F3NO3S/c1-13(2,18-8-5-9-22(19,20)21)10-11-6-3-4-7-12(11)14(15,16)17/h3-4,6-7,18H,5,8-10H2,1-2H3,(H,19,20,21) |
| InChIKey | PDPKOWVIDPAEKD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|