C13H18F3NO3S — CID 58691944
3-[2-[4-(trifluoromethyl)phenyl]propan-2-ylamino]propane-1-sulfonic acid (PubChem CID 58691944) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 3-[2-[4-(trifluoromethyl)phenyl]propan-2-ylamino]propane-1-sulfonic acid.
| Compound Name | 3-[2-[4-(trifluoromethyl)phenyl]propan-2-ylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691944 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-[2-[4-(trifluoromethyl)phenyl]propan-2-ylamino]propane-1-sulfonic acid |
| SMILES | CC(C)(NCCCS(=O)(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-12(2,17-8-3-9-21(18,19)20)10-4-6-11(7-5-10)13(14,15)16/h4-7,17H,3,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | XEZSALRAUCEDKD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|