C19H32N2O3S — CID 143275329
3-[[1-[[4-(2-aminopropan-2-yl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid (PubChem CID 143275329) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is 3-[[1-[[4-(2-aminopropan-2-yl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[1-[[4-(2-aminopropan-2-yl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 143275329 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-[[1-[[4-(2-aminopropan-2-yl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)(N)c1ccc(CC2(NCCCS(=O)(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C19H32N2O3S/c1-18(2,20)17-9-7-16(8-10-17)15-19(11-4-3-5-12-19)21-13-6-14-25(22,23)24/h7-10,21H,3-6,11-15,20H2,1-2H3,(H,22,23,24) |
| InChIKey | CZURUKNUSQTUIM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|