C16H27NO4S — CID 11976815
3-[[2-methyl-1-(4-propoxyphenyl)propan-2-yl]amino]propane-1-sulfonic acid (PubChem CID 11976815) has the molecular formula C16H27NO4S and a molecular weight of 329.46 g/mol. Its IUPAC name is 3-[[2-methyl-1-(4-propoxyphenyl)propan-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[2-methyl-1-(4-propoxyphenyl)propan-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 11976815 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[[2-methyl-1-(4-propoxyphenyl)propan-2-yl]amino]propane-1-sulfonic acid |
| SMILES | CCCOc1ccc(CC(C)(C)NCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H27NO4S/c1-4-11-21-15-8-6-14(7-9-15)13-16(2,3)17-10-5-12-22(18,19)20/h6-9,17H,4-5,10-13H2,1-3H3,(H,18,19,20) |
| InChIKey | SGTJNIJPWRSBBA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|