C26H39NO4 — CID 10296289
(2S)-1-(4-hexoxyphenoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol (PubChem CID 10296289) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is (2S)-1-(4-hexoxyphenoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol.
| Compound Name | (2S)-1-(4-hexoxyphenoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 10296289 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | (2S)-1-(4-hexoxyphenoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol |
| SMILES | CCCCCCOc1ccc(OC[C@@H](O)CNC(C)(C)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H39NO4/c1-5-6-7-8-17-30-24-13-15-25(16-14-24)31-20-22(28)19-27-26(2,3)18-21-9-11-23(29-4)12-10-21/h9-16,22,27-28H,5-8,17-20H2,1-4H3/t22-/m0/s1 |
| InChIKey | CZKSAOPPQKIWQX-QFIPXVFZSA-N |
| XLogP | 5.00 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|