C24H29NO3 — CID 59040452
(2R)-1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-naphthalen-1-yloxypropan-2-ol (PubChem CID 59040452) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (2R)-1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-naphthalen-1-yloxypropan-2-ol.
| Compound Name | (2R)-1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 59040452 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (2R)-1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-naphthalen-1-yloxypropan-2-ol |
| SMILES | COc1ccc(CC(C)(C)NC[C@@H](O)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-24(2,15-18-11-13-21(27-3)14-12-18)25-16-20(26)17-28-23-10-6-8-19-7-4-5-9-22(19)23/h4-14,20,25-26H,15-17H2,1-3H3/t20-/m1/s1 |
| InChIKey | DNPLKAPMAGXXOP-HXUWFJFHSA-N |
| XLogP | 4.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |