C21H29NO2 — CID 22640950
1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-4-phenylbutan-2-ol (PubChem CID 22640950) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-4-phenylbutan-2-ol.
| Compound Name | 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 22640950 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-4-phenylbutan-2-ol |
| SMILES | COc1ccc(CC(C)(C)NCC(O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-21(2,15-18-10-13-20(24-3)14-11-18)22-16-19(23)12-9-17-7-5-4-6-8-17/h4-8,10-11,13-14,19,22-23H,9,12,15-16H2,1-3H3 |
| InChIKey | GVPOOJWBFZXRLT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |