C22H39NO3 — CID 59040453
(2R)-1-(2-ethylhexoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol (PubChem CID 59040453) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is (2R)-1-(2-ethylhexoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol.
| Compound Name | (2R)-1-(2-ethylhexoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 59040453 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | (2R)-1-(2-ethylhexoxy)-3-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]propan-2-ol |
| SMILES | CCCCC(CC)COC[C@H](O)CNC(C)(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H39NO3/c1-6-8-9-18(7-2)16-26-17-20(24)15-23-22(3,4)14-19-10-12-21(25-5)13-11-19/h10-13,18,20,23-24H,6-9,14-17H2,1-5H3/t18?,20-/m1/s1 |
| InChIKey | OMPKFMJLRFWAOG-ROPPNANJSA-N |
| XLogP | 4.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |