C21H35NO2 — CID 22640829
1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]dec-9-en-2-ol (PubChem CID 22640829) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]dec-9-en-2-ol.
| Compound Name | 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]dec-9-en-2-ol |
|---|---|
| PubChem CID | 22640829 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]dec-9-en-2-ol |
| SMILES | C=CCCCCCCC(O)CNC(C)(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H35NO2/c1-5-6-7-8-9-10-11-19(23)17-22-21(2,3)16-18-12-14-20(24-4)15-13-18/h5,12-15,19,22-23H,1,6-11,16-17H2,2-4H3 |
| InChIKey | LJVMNXFMMAVBAA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|