C17H24F3NO4S — CID 58691925
3-[[1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid (PubChem CID 58691925) has the molecular formula C17H24F3NO4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-[[1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691925 |
| Molecular Formula | C17H24F3NO4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-[[1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]cyclohexyl]amino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNC1(C(O)c2cccc(C(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C17H24F3NO4S/c18-17(19,20)14-7-4-6-13(12-14)15(22)16(8-2-1-3-9-16)21-10-5-11-26(23,24)25/h4,6-7,12,15,21-22H,1-3,5,8-11H2,(H,23,24,25) |
| InChIKey | MYZZVSNNEZJLBT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|