C16H25NO5S — CID 11976873
3-[[1-[hydroxy-(3-methoxyphenyl)methyl]cyclopentyl]amino]propane-1-sulfonic acid (PubChem CID 11976873) has the molecular formula C16H25NO5S and a molecular weight of 343.44 g/mol. Its IUPAC name is 3-[[1-[hydroxy-(3-methoxyphenyl)methyl]cyclopentyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[1-[hydroxy-(3-methoxyphenyl)methyl]cyclopentyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 11976873 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[[1-[hydroxy-(3-methoxyphenyl)methyl]cyclopentyl]amino]propane-1-sulfonic acid |
| SMILES | COc1cccc(C(O)C2(NCCCS(=O)(=O)O)CCCC2)c1 |
| InChI | InChI=1S/C16H25NO5S/c1-22-14-7-4-6-13(12-14)15(18)16(8-2-3-9-16)17-10-5-11-23(19,20)21/h4,6-7,12,15,17-18H,2-3,5,8-11H2,1H3,(H,19,20,21) |
| InChIKey | CTUFTYIFLTVUQC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|