C15H23NO4S — CID 110626462
N-[(1-hydroxycyclopentyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide (PubChem CID 110626462) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[(1-hydroxycyclopentyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide.
| Compound Name | N-[(1-hydroxycyclopentyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110626462 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[(1-hydroxycyclopentyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide |
| SMILES | COc1cccc(CCS(=O)(=O)NCC2(O)CCCC2)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-20-14-6-4-5-13(11-14)7-10-21(18,19)16-12-15(17)8-2-3-9-15/h4-6,11,16-17H,2-3,7-10,12H2,1H3 |
| InChIKey | HOKLBANWQXFAKY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |