C15H19F3O2 — CID 103452414
1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-4-methylcyclohexan-1-ol (PubChem CID 103452414) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 103452414 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[hydroxy-[3-(trifluoromethyl)phenyl]methyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)(C(O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H19F3O2/c1-10-5-7-14(20,8-6-10)13(19)11-3-2-4-12(9-11)15(16,17)18/h2-4,9-10,13,19-20H,5-8H2,1H3 |
| InChIKey | SRLBZXZKMQWDCK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |