C18H24F3N — CID 156602633
(3S)-7-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[3.5]nonan-3-amine (PubChem CID 156602633) has the molecular formula C18H24F3N and a molecular weight of 311.39 g/mol. Its IUPAC name is (3S)-7-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[3.5]nonan-3-amine.
| Compound Name | (3S)-7-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[3.5]nonan-3-amine |
|---|---|
| PubChem CID | 156602633 |
| Molecular Formula | C18H24F3N |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (3S)-7-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[3.5]nonan-3-amine |
| SMILES | CC1CCC2(CC1)CC[C@@H]2NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H24F3N/c1-13-5-8-17(9-6-13)10-7-16(17)22-12-14-3-2-4-15(11-14)18(19,20)21/h2-4,11,13,16,22H,5-10,12H2,1H3/t13?,16-,17?/m0/s1 |
| InChIKey | CXRRPQKXECDVQQ-PWZRNIHTSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |