C12H11F6N — CID 106209964
1-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine (PubChem CID 106209964) has the molecular formula C12H11F6N and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine.
| Compound Name | 1-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 106209964 |
| Molecular Formula | C12H11F6N |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-(trifluoromethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine |
| SMILES | FC(F)(F)c1cccc(CNC2(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C12H11F6N/c13-11(14,15)9-3-1-2-8(6-9)7-19-10(4-5-10)12(16,17)18/h1-3,6,19H,4-5,7H2 |
| InChIKey | RHINHRKXVRHYHL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |