C11H12F4N2 — CID 114159735
2-fluoro-6-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline (PubChem CID 114159735) has the molecular formula C11H12F4N2 and a molecular weight of 248.22 g/mol. Its IUPAC name is 2-fluoro-6-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline.
| Compound Name | 2-fluoro-6-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline |
|---|---|
| PubChem CID | 114159735 |
| Molecular Formula | C11H12F4N2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-fluoro-6-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline |
| SMILES | Nc1c(F)cccc1CNC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H12F4N2/c12-8-3-1-2-7(9(8)16)6-17-10(4-5-10)11(13,14)15/h1-3,17H,4-6,16H2 |
| InChIKey | TUMQUDGOWAMYNU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|