C11H12BrF3N2 — CID 106219106
5-bromo-2-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline (PubChem CID 106219106) has the molecular formula C11H12BrF3N2 and a molecular weight of 309.13 g/mol. Its IUPAC name is 5-bromo-2-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline.
| Compound Name | 5-bromo-2-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline |
|---|---|
| PubChem CID | 106219106 |
| Molecular Formula | C11H12BrF3N2 |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 5-bromo-2-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]aniline |
| SMILES | Nc1cc(Br)ccc1CNC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H12BrF3N2/c12-8-2-1-7(9(16)5-8)6-17-10(3-4-10)11(13,14)15/h1-2,5,17H,3-4,6,16H2 |
| InChIKey | FYZFLTOVOXMZQP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|