C12H10F4N2 — CID 106212220
2-fluoro-3-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]benzonitrile (PubChem CID 106212220) has the molecular formula C12H10F4N2 and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-fluoro-3-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]benzonitrile.
| Compound Name | 2-fluoro-3-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 106212220 |
| Molecular Formula | C12H10F4N2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-fluoro-3-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNC2(C(F)(F)F)CC2)c1F |
| InChI | InChI=1S/C12H10F4N2/c13-10-8(6-17)2-1-3-9(10)7-18-11(4-5-11)12(14,15)16/h1-3,18H,4-5,7H2 |
| InChIKey | VJIYQVZWNDOQCK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |