C15H25BrN2 — CID 79712891
5-bromo-2-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline (PubChem CID 79712891) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 5-bromo-2-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline.
| Compound Name | 5-bromo-2-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 79712891 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-bromo-2-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline |
| SMILES | CC(C)(C)CC(C)(C)NCc1ccc(Br)cc1N |
| InChI | InChI=1S/C15H25BrN2/c1-14(2,3)10-15(4,5)18-9-11-6-7-12(16)8-13(11)17/h6-8,18H,9-10,17H2,1-5H3 |
| InChIKey | YIUWUDHLNPGJEL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|