C10H11BrF4N2 — CID 106293884
5-bromo-2-[(2,2,3,3-tetrafluoropropylamino)methyl]aniline (PubChem CID 106293884) has the molecular formula C10H11BrF4N2 and a molecular weight of 315.11 g/mol. Its IUPAC name is 5-bromo-2-[(2,2,3,3-tetrafluoropropylamino)methyl]aniline.
| Compound Name | 5-bromo-2-[(2,2,3,3-tetrafluoropropylamino)methyl]aniline |
|---|---|
| PubChem CID | 106293884 |
| Molecular Formula | C10H11BrF4N2 |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-bromo-2-[(2,2,3,3-tetrafluoropropylamino)methyl]aniline |
| SMILES | Nc1cc(Br)ccc1CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H11BrF4N2/c11-7-2-1-6(8(16)3-7)4-17-5-10(14,15)9(12)13/h1-3,9,17H,4-5,16H2 |
| InChIKey | PPTGJQVOIAKVAB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|