C15H23BrN2 — CID 79713598
5-bromo-2-[[(2,2,3,3-tetramethylcyclopropyl)methylamino]methyl]aniline (PubChem CID 79713598) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 5-bromo-2-[[(2,2,3,3-tetramethylcyclopropyl)methylamino]methyl]aniline.
| Compound Name | 5-bromo-2-[[(2,2,3,3-tetramethylcyclopropyl)methylamino]methyl]aniline |
|---|---|
| PubChem CID | 79713598 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-bromo-2-[[(2,2,3,3-tetramethylcyclopropyl)methylamino]methyl]aniline |
| SMILES | CC1(C)C(CNCc2ccc(Br)cc2N)C1(C)C |
| InChI | InChI=1S/C15H23BrN2/c1-14(2)13(15(14,3)4)9-18-8-10-5-6-11(16)7-12(10)17/h5-7,13,18H,8-9,17H2,1-4H3 |
| InChIKey | NQXOHVCOVSRSRE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|