C16H27BrN2 — CID 107815766
5-bromo-2-[(7-methyloctylamino)methyl]aniline (PubChem CID 107815766) has the molecular formula C16H27BrN2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 5-bromo-2-[(7-methyloctylamino)methyl]aniline.
| Compound Name | 5-bromo-2-[(7-methyloctylamino)methyl]aniline |
|---|---|
| PubChem CID | 107815766 |
| Molecular Formula | C16H27BrN2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-bromo-2-[(7-methyloctylamino)methyl]aniline |
| SMILES | CC(C)CCCCCCNCc1ccc(Br)cc1N |
| InChI | InChI=1S/C16H27BrN2/c1-13(2)7-5-3-4-6-10-19-12-14-8-9-15(17)11-16(14)18/h8-9,11,13,19H,3-7,10,12,18H2,1-2H3 |
| InChIKey | LVHYNWNAOQBHMB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|