C16H28N2O — CID 107208352
3-methoxy-4-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline (PubChem CID 107208352) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-methoxy-4-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline.
| Compound Name | 3-methoxy-4-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 107208352 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-methoxy-4-[(2,4,4-trimethylpentan-2-ylamino)methyl]aniline |
| SMILES | COc1cc(N)ccc1CNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H28N2O/c1-15(2,3)11-16(4,5)18-10-12-7-8-13(17)9-14(12)19-6/h7-9,18H,10-11,17H2,1-6H3 |
| InChIKey | KTKAWDMUGSUNTL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|