C14H23FN2 — CID 83143874
2-fluoro-6-[(2,3,3-trimethylbutylamino)methyl]aniline (PubChem CID 83143874) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-fluoro-6-[(2,3,3-trimethylbutylamino)methyl]aniline.
| Compound Name | 2-fluoro-6-[(2,3,3-trimethylbutylamino)methyl]aniline |
|---|---|
| PubChem CID | 83143874 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 2-fluoro-6-[(2,3,3-trimethylbutylamino)methyl]aniline |
| SMILES | CC(CNCc1cccc(F)c1N)C(C)(C)C |
| InChI | InChI=1S/C14H23FN2/c1-10(14(2,3)4)8-17-9-11-6-5-7-12(15)13(11)16/h5-7,10,17H,8-9,16H2,1-4H3 |
| InChIKey | GFXWMRUHWBQBBD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|