C14H22ClN — CID 83142139
N-[(3-chlorophenyl)methyl]-2,3,3-trimethylbutan-1-amine (PubChem CID 83142139) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2,3,3-trimethylbutan-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-2,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 83142139 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2,3,3-trimethylbutan-1-amine |
| SMILES | CC(CNCc1cccc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C14H22ClN/c1-11(14(2,3)4)9-16-10-12-6-5-7-13(15)8-12/h5-8,11,16H,9-10H2,1-4H3 |
| InChIKey | OGQINDUDUPQKLM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |