C13H20ClN — CID 64570853
N-[(3-chlorophenyl)methyl]-2,3-dimethylbutan-1-amine (PubChem CID 64570853) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2,3-dimethylbutan-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 64570853 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2,3-dimethylbutan-1-amine |
| SMILES | CC(C)C(C)CNCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-10(2)11(3)8-15-9-12-5-4-6-13(14)7-12/h4-7,10-11,15H,8-9H2,1-3H3 |
| InChIKey | ZENRPHZCQSULCQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |