C13H21Cl2NO — CID 115598038
1-[(3-chlorophenyl)methylamino]-4-methylpentan-2-ol;hydrochloride (PubChem CID 115598038) has the molecular formula C13H21Cl2NO and a molecular weight of 278.22 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methylamino]-4-methylpentan-2-ol;hydrochloride.
| Compound Name | 1-[(3-chlorophenyl)methylamino]-4-methylpentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 115598038 |
| Molecular Formula | C13H21Cl2NO |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(3-chlorophenyl)methylamino]-4-methylpentan-2-ol;hydrochloride |
| SMILES | CC(C)CC(O)CNCc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C13H20ClNO.ClH/c1-10(2)6-13(16)9-15-8-11-4-3-5-12(14)7-11;/h3-5,7,10,13,15-16H,6,8-9H2,1-2H3;1H |
| InChIKey | MEVSEOILATWLSI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |