C14H21ClO — CID 141283278
1-(3-chlorophenyl)-6-methylheptan-4-ol (PubChem CID 141283278) has the molecular formula C14H21ClO and a molecular weight of 240.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-methylheptan-4-ol.
| Compound Name | 1-(3-chlorophenyl)-6-methylheptan-4-ol |
|---|---|
| PubChem CID | 141283278 |
| Molecular Formula | C14H21ClO |
| Molecular Weight | 240.77 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(3-chlorophenyl)-6-methylheptan-4-ol |
| SMILES | CC(C)CC(O)CCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21ClO/c1-11(2)9-14(16)8-4-6-12-5-3-7-13(15)10-12/h3,5,7,10-11,14,16H,4,6,8-9H2,1-2H3 |
| InChIKey | SUSRHSLHVUDPCQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |